About (4-nitrophenyl) butanoate;2-(4-nitrophenyl)butanoic acid
(4-nitrophenyl) butanoate;2-(4-nitrophenyl)butanoic acid (PubChem CID 159031009) has the molecular formula C20H22N2O8
and a molecular weight of 418.40 g/mol. Its IUPAC name is (4-nitrophenyl) butanoate;2-(4-nitrophenyl)butanoic acid.
Molecular Properties
| Compound Name | (4-nitrophenyl) butanoate;2-(4-nitrophenyl)butanoic acid |
| PubChem CID | 159031009 |
| Molecular Formula | C20H22N2O8 |
| Molecular Weight | 418.40 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | (4-nitrophenyl) butanoate;2-(4-nitrophenyl)butanoic acid |
| SMILES | CCC(C(=O)O)c1ccc([N+](=O)[O-])cc1.CCCC(=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/2C10H11NO4/c1-2-9(10(12)13)7-3-5-8(6-4-7)11(14)15;1-2-3-10(12)15-9-6-4-8(5-7-9)11(13)14/h3-6,9H,2H2,1H3,(H,12,13);4-7H,2-3H2,1H3 |
| InChIKey | JUWPESBDBCQAAP-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 149.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.40 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-nitrophenyl) butanoate;2-(4-nitrophenyl)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-nitrophenyl) butanoate;2-(4-nitrophenyl)butanoic acid?
The IUPAC name of (4-nitrophenyl) butanoate;2-(4-nitrophenyl)butanoic acid (CID 159031009) is (4-nitrophenyl) butanoate;2-(4-nitrophenyl)butanoic acid.
What is the SMILES notation for (4-nitrophenyl) butanoate;2-(4-nitrophenyl)butanoic acid?
The canonical SMILES for (4-nitrophenyl) butanoate;2-(4-nitrophenyl)butanoic acid is CCC(C(=O)O)c1ccc([N+](=O)[O-])cc1.CCCC(=O)Oc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of (4-nitrophenyl) butanoate;2-(4-nitrophenyl)butanoic acid?
The InChIKey is JUWPESBDBCQAAP-UHFFFAOYSA-N. The full InChI is InChI=1S/2C10H11NO4/c1-2-9(10(12)13)7-3-5-8(6-4-7)11(14)15;1-2-3-10(12)15-9-6-4-8(5-7-9)11(13)14/h3-6,9H,2H2,1H3,(H,12,13);4-7H,2-3H2,1H3.
What are the key properties of (4-nitrophenyl) butanoate;2-(4-nitrophenyl)butanoic acid?
(4-nitrophenyl) butanoate;2-(4-nitrophenyl)butanoic acid has a molecular weight of 418.40 g/mol, XLogP of 4.47, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (4-nitrophenyl) butanoate;2-(4-nitrophenyl)butanoic acid is sourced from PubChem (CID 159031009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).