About bis(4-nitrophenyl) hexanedioate;ethanamine;ethane
bis(4-nitrophenyl) hexanedioate;ethanamine;ethane (PubChem CID 145050607) has the molecular formula C22H29N3O8
and a molecular weight of 463.49 g/mol. Its IUPAC name is bis(4-nitrophenyl) hexanedioate;ethanamine;ethane.
Molecular Properties
| Compound Name | bis(4-nitrophenyl) hexanedioate;ethanamine;ethane |
| PubChem CID | 145050607 |
| Molecular Formula | C22H29N3O8 |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | bis(4-nitrophenyl) hexanedioate;ethanamine;ethane |
| SMILES | CC.CCN.O=C(CCCCC(=O)Oc1ccc([N+](=O)[O-])cc1)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H16N2O8.C2H7N.C2H6/c21-17(27-15-9-5-13(6-10-15)19(23)24)3-1-2-4-18(22)28-16-11-7-14(8-12-16)20(25)26;1-2-3;1-2/h5-12H,1-4H2;2-3H2,1H3;1-2H3 |
| InChIKey | MQFSRDWJBLOIOF-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 164.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze bis(4-nitrophenyl) hexanedioate;ethanamine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-nitrophenyl) hexanedioate;ethanamine;ethane?
The IUPAC name of bis(4-nitrophenyl) hexanedioate;ethanamine;ethane (CID 145050607) is bis(4-nitrophenyl) hexanedioate;ethanamine;ethane.
What is the SMILES notation for bis(4-nitrophenyl) hexanedioate;ethanamine;ethane?
The canonical SMILES for bis(4-nitrophenyl) hexanedioate;ethanamine;ethane is CC.CCN.O=C(CCCCC(=O)Oc1ccc([N+](=O)[O-])cc1)Oc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of bis(4-nitrophenyl) hexanedioate;ethanamine;ethane?
The InChIKey is MQFSRDWJBLOIOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N2O8.C2H7N.C2H6/c21-17(27-15-9-5-13(6-10-15)19(23)24)3-1-2-4-18(22)28-16-11-7-14(8-12-16)20(25)26;1-2-3;1-2/h5-12H,1-4H2;2-3H2,1H3;1-2H3.
What are the key properties of bis(4-nitrophenyl) hexanedioate;ethanamine;ethane?
bis(4-nitrophenyl) hexanedioate;ethanamine;ethane has a molecular weight of 463.49 g/mol, XLogP of 4.57, 9 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-nitrophenyl) hexanedioate;ethanamine;ethane is sourced from PubChem (CID 145050607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).