About bis(4-nitrophenyl) decanedioate;3-nitroprop-1-ene
bis(4-nitrophenyl) decanedioate;3-nitroprop-1-ene (PubChem CID 145459160) has the molecular formula C25H29N3O10
and a molecular weight of 531.52 g/mol. Its IUPAC name is bis(4-nitrophenyl) decanedioate;3-nitroprop-1-ene.
Molecular Properties
| Compound Name | bis(4-nitrophenyl) decanedioate;3-nitroprop-1-ene |
| PubChem CID | 145459160 |
| Molecular Formula | C25H29N3O10 |
| Molecular Weight | 531.52 g/mol |
| Exact Mass | 531.19 |
| IUPAC Name | bis(4-nitrophenyl) decanedioate;3-nitroprop-1-ene |
| SMILES | C=CC[N+](=O)[O-].O=C(CCCCCCCCC(=O)Oc1ccc([N+](=O)[O-])cc1)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H24N2O8.C3H5NO2/c25-21(31-19-13-9-17(10-14-19)23(27)28)7-5-3-1-2-4-6-8-22(26)32-20-15-11-18(12-16-20)24(29)30;1-2-3-4(5)6/h9-16H,1-8H2;2H,1,3H2 |
| InChIKey | JQDFFZWLRBOXCF-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 182.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 531.52 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze bis(4-nitrophenyl) decanedioate;3-nitroprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-nitrophenyl) decanedioate;3-nitroprop-1-ene?
The IUPAC name of bis(4-nitrophenyl) decanedioate;3-nitroprop-1-ene (CID 145459160) is bis(4-nitrophenyl) decanedioate;3-nitroprop-1-ene.
What is the SMILES notation for bis(4-nitrophenyl) decanedioate;3-nitroprop-1-ene?
The canonical SMILES for bis(4-nitrophenyl) decanedioate;3-nitroprop-1-ene is C=CC[N+](=O)[O-].O=C(CCCCCCCCC(=O)Oc1ccc([N+](=O)[O-])cc1)Oc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of bis(4-nitrophenyl) decanedioate;3-nitroprop-1-ene?
The InChIKey is JQDFFZWLRBOXCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N2O8.C3H5NO2/c25-21(31-19-13-9-17(10-14-19)23(27)28)7-5-3-1-2-4-6-8-22(26)32-20-15-11-18(12-16-20)24(29)30;1-2-3-4(5)6/h9-16H,1-8H2;2H,1,3H2.
What are the key properties of bis(4-nitrophenyl) decanedioate;3-nitroprop-1-ene?
bis(4-nitrophenyl) decanedioate;3-nitroprop-1-ene has a molecular weight of 531.52 g/mol, XLogP of 5.58, 15 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-nitrophenyl) decanedioate;3-nitroprop-1-ene is sourced from PubChem (CID 145459160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).