About methane;6-(4-nitrophenoxy)hexanoyl chloride;(4-nitrophenyl) 6-(4-nitrophenoxy)hexanoate
methane;6-(4-nitrophenoxy)hexanoyl chloride;(4-nitrophenyl) 6-(4-nitrophenoxy)hexanoate (PubChem CID 157292792) has the molecular formula C31H36ClN3O11
and a molecular weight of 662.09 g/mol. Its IUPAC name is methane;6-(4-nitrophenoxy)hexanoyl chloride;(4-nitrophenyl) 6-(4-nitrophenoxy)hexanoate.
Molecular Properties
| Compound Name | methane;6-(4-nitrophenoxy)hexanoyl chloride;(4-nitrophenyl) 6-(4-nitrophenoxy)hexanoate |
| PubChem CID | 157292792 |
| Molecular Formula | C31H36ClN3O11 |
| Molecular Weight | 662.09 g/mol |
| Exact Mass | 661.20 |
| IUPAC Name | methane;6-(4-nitrophenoxy)hexanoyl chloride;(4-nitrophenyl) 6-(4-nitrophenoxy)hexanoate |
| SMILES | C.O=C(CCCCCOc1ccc([N+](=O)[O-])cc1)Oc1ccc([N+](=O)[O-])cc1.O=C(Cl)CCCCCOc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H18N2O7.C12H14ClNO4.CH4/c21-18(27-17-11-7-15(8-12-17)20(24)25)4-2-1-3-13-26-16-9-5-14(6-10-16)19(22)23;13-12(15)4-2-1-3-9-18-11-7-5-10(6-8-11)14(16)17;/h5-12H,1-4,13H2;5-8H,1-4,9H2;1H4 |
| InChIKey | BAZNRNGLHXBFSF-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 191.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 662.09 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze methane;6-(4-nitrophenoxy)hexanoyl chloride;(4-nitrophenyl) 6-(4-nitrophenoxy)hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;6-(4-nitrophenoxy)hexanoyl chloride;(4-nitrophenyl) 6-(4-nitrophenoxy)hexanoate?
The IUPAC name of methane;6-(4-nitrophenoxy)hexanoyl chloride;(4-nitrophenyl) 6-(4-nitrophenoxy)hexanoate (CID 157292792) is methane;6-(4-nitrophenoxy)hexanoyl chloride;(4-nitrophenyl) 6-(4-nitrophenoxy)hexanoate.
What is the SMILES notation for methane;6-(4-nitrophenoxy)hexanoyl chloride;(4-nitrophenyl) 6-(4-nitrophenoxy)hexanoate?
The canonical SMILES for methane;6-(4-nitrophenoxy)hexanoyl chloride;(4-nitrophenyl) 6-(4-nitrophenoxy)hexanoate is C.O=C(CCCCCOc1ccc([N+](=O)[O-])cc1)Oc1ccc([N+](=O)[O-])cc1.O=C(Cl)CCCCCOc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of methane;6-(4-nitrophenoxy)hexanoyl chloride;(4-nitrophenyl) 6-(4-nitrophenoxy)hexanoate?
The InChIKey is BAZNRNGLHXBFSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N2O7.C12H14ClNO4.CH4/c21-18(27-17-11-7-15(8-12-17)20(24)25)4-2-1-3-13-26-16-9-5-14(6-10-16)19(22)23;13-12(15)4-2-1-3-9-18-11-7-5-10(6-8-11)14(16)17;/h5-12H,1-4,13H2;5-8H,1-4,9H2;1H4.
What are the key properties of methane;6-(4-nitrophenoxy)hexanoyl chloride;(4-nitrophenyl) 6-(4-nitrophenoxy)hexanoate?
methane;6-(4-nitrophenoxy)hexanoyl chloride;(4-nitrophenyl) 6-(4-nitrophenoxy)hexanoate has a molecular weight of 662.09 g/mol, XLogP of 7.98, 18 rotatable bonds, 0 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for methane;6-(4-nitrophenoxy)hexanoyl chloride;(4-nitrophenyl) 6-(4-nitrophenoxy)hexanoate is sourced from PubChem (CID 157292792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).