About (4-nitrophenyl) 5-nitrooxyhexanoate
(4-nitrophenyl) 5-nitrooxyhexanoate (PubChem CID 87101565) has the molecular formula C12H14N2O7
and a molecular weight of 298.25 g/mol. Its IUPAC name is (4-nitrophenyl) 5-nitrooxyhexanoate.
Molecular Properties
| Compound Name | (4-nitrophenyl) 5-nitrooxyhexanoate |
| PubChem CID | 87101565 |
| Molecular Formula | C12H14N2O7 |
| Molecular Weight | 298.25 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | (4-nitrophenyl) 5-nitrooxyhexanoate |
| SMILES | CC(CCCC(=O)Oc1ccc([N+](=O)[O-])cc1)O[N+](=O)[O-] |
| InChI | InChI=1S/C12H14N2O7/c1-9(21-14(18)19)3-2-4-12(15)20-11-7-5-10(6-8-11)13(16)17/h5-9H,2-4H2,1H3 |
| InChIKey | ZUNVSFAJYQZBJY-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 121.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.25 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-nitrophenyl) 5-nitrooxyhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-nitrophenyl) 5-nitrooxyhexanoate?
The IUPAC name of (4-nitrophenyl) 5-nitrooxyhexanoate (CID 87101565) is (4-nitrophenyl) 5-nitrooxyhexanoate.
What is the SMILES notation for (4-nitrophenyl) 5-nitrooxyhexanoate?
The canonical SMILES for (4-nitrophenyl) 5-nitrooxyhexanoate is CC(CCCC(=O)Oc1ccc([N+](=O)[O-])cc1)O[N+](=O)[O-].
What is the InChIKey of (4-nitrophenyl) 5-nitrooxyhexanoate?
The InChIKey is ZUNVSFAJYQZBJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O7/c1-9(21-14(18)19)3-2-4-12(15)20-11-7-5-10(6-8-11)13(16)17/h5-9H,2-4H2,1H3.
What are the key properties of (4-nitrophenyl) 5-nitrooxyhexanoate?
(4-nitrophenyl) 5-nitrooxyhexanoate has a molecular weight of 298.25 g/mol, XLogP of 2.27, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (4-nitrophenyl) 5-nitrooxyhexanoate is sourced from PubChem (CID 87101565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).