About 5-methylhexan-2-yl (4-nitrophenyl) carbonate
5-methylhexan-2-yl (4-nitrophenyl) carbonate (PubChem CID 54052953) has the molecular formula C14H19NO5
and a molecular weight of 281.31 g/mol. Its IUPAC name is 5-methylhexan-2-yl (4-nitrophenyl) carbonate.
Molecular Properties
| Compound Name | 5-methylhexan-2-yl (4-nitrophenyl) carbonate |
| PubChem CID | 54052953 |
| Molecular Formula | C14H19NO5 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 5-methylhexan-2-yl (4-nitrophenyl) carbonate |
| SMILES | CC(C)CCC(C)OC(=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H19NO5/c1-10(2)4-5-11(3)19-14(16)20-13-8-6-12(7-9-13)15(17)18/h6-11H,4-5H2,1-3H3 |
| InChIKey | LUFHHCIDOPAWSK-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze 5-methylhexan-2-yl (4-nitrophenyl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylhexan-2-yl (4-nitrophenyl) carbonate?
The IUPAC name of 5-methylhexan-2-yl (4-nitrophenyl) carbonate (CID 54052953) is 5-methylhexan-2-yl (4-nitrophenyl) carbonate.
What is the SMILES notation for 5-methylhexan-2-yl (4-nitrophenyl) carbonate?
The canonical SMILES for 5-methylhexan-2-yl (4-nitrophenyl) carbonate is CC(C)CCC(C)OC(=O)Oc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of 5-methylhexan-2-yl (4-nitrophenyl) carbonate?
The InChIKey is LUFHHCIDOPAWSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO5/c1-10(2)4-5-11(3)19-14(16)20-13-8-6-12(7-9-13)15(17)18/h6-11H,4-5H2,1-3H3.
What are the key properties of 5-methylhexan-2-yl (4-nitrophenyl) carbonate?
5-methylhexan-2-yl (4-nitrophenyl) carbonate has a molecular weight of 281.31 g/mol, XLogP of 3.93, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylhexan-2-yl (4-nitrophenyl) carbonate is sourced from PubChem (CID 54052953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).