C33H48Br2O3 — CID 150375508
1,5-dibromo-2,4-bis(4-octoxyphenyl)pentan-3-one (PubChem CID 150375508) has the molecular formula C33H48Br2O3 and a molecular weight of 652.55 g/mol. Its IUPAC name is 1,5-dibromo-2,4-bis(4-octoxyphenyl)pentan-3-one.
| Compound Name | 1,5-dibromo-2,4-bis(4-octoxyphenyl)pentan-3-one |
|---|---|
| PubChem CID | 150375508 |
| Molecular Formula | C33H48Br2O3 |
| Molecular Weight | 652.55 g/mol |
| Exact Mass | 650.20 |
| IUPAC Name | 1,5-dibromo-2,4-bis(4-octoxyphenyl)pentan-3-one |
| SMILES | CCCCCCCCOc1ccc(C(CBr)C(=O)C(CBr)c2ccc(OCCCCCCCC)cc2)cc1 |
| InChI | InChI=1S/C33H48Br2O3/c1-3-5-7-9-11-13-23-37-29-19-15-27(16-20-29)31(25-34)33(36)32(26-35)28-17-21-30(22-18-28)38-24-14-12-10-8-6-4-2/h15-22,31-32H,3-14,23-26H2,1-2H3 |
| InChIKey | GYPNJWXVBBRFPC-UHFFFAOYSA-N |
| XLogP | 10.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.55 |
| LogP ≤ 5 | 10.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|