C18H24NaO8P2 — CID 172652800
CID 172652800 (PubChem CID 172652800) has the molecular formula C18H24NaO8P2 and a molecular weight of 453.32 g/mol.
| Compound Name | CID 172652800 |
|---|---|
| PubChem CID | 172652800 |
| Molecular Formula | C18H24NaO8P2 |
| Molecular Weight | 453.32 g/mol |
| Exact Mass | 453.08 |
| IUPAC Name | — |
| SMILES | CC[C@H](c1ccc(OP(=O)(O)O)cc1)[C@@H](CC)c1ccc(OP(=O)(O)O)cc1.[Na] |
| InChI | InChI=1S/C18H24O8P2.Na/c1-3-17(13-5-9-15(10-6-13)25-27(19,20)21)18(4-2)14-7-11-16(12-8-14)26-28(22,23)24;/h5-12,17-18H,3-4H2,1-2H3,(H2,19,20,21)(H2,22,23,24);/t17-,18+; |
| InChIKey | RFQHDESBEJJKCH-GNXQHMNLSA-N |
| XLogP | 3.94 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.32 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|