C26H31O4P — CID 169434722
bis(2-tert-butylphenyl) (2,3,4,5,6-pentadeuteriophenyl) phosphate (PubChem CID 169434722) has the molecular formula C26H31O4P and a molecular weight of 443.53 g/mol. Its IUPAC name is bis(2-tert-butylphenyl) (2,3,4,5,6-pentadeuteriophenyl) phosphate.
| Compound Name | bis(2-tert-butylphenyl) (2,3,4,5,6-pentadeuteriophenyl) phosphate |
|---|---|
| PubChem CID | 169434722 |
| Molecular Formula | C26H31O4P |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | bis(2-tert-butylphenyl) (2,3,4,5,6-pentadeuteriophenyl) phosphate |
| SMILES | [2H]c1c([2H])c([2H])c(OP(=O)(Oc2ccccc2C(C)(C)C)Oc2ccccc2C(C)(C)C)c([2H])c1[2H] |
| InChI | InChI=1S/C26H31O4P/c1-25(2,3)21-16-10-12-18-23(21)29-31(27,28-20-14-8-7-9-15-20)30-24-19-13-11-17-22(24)26(4,5)6/h7-19H,1-6H3/i7D,8D,9D,14D,15D |
| InChIKey | UQRSMZHDWDMLDH-CFPNEJFESA-N |
| XLogP | 7.93 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|