C16H18 — CID 140946173
1-(2-tert-butylphenyl)-2,3,4,5,6-pentadeuteriobenzene (PubChem CID 140946173) has the molecular formula C16H18 and a molecular weight of 215.35 g/mol. Its IUPAC name is 1-(2-tert-butylphenyl)-2,3,4,5,6-pentadeuteriobenzene.
| Compound Name | 1-(2-tert-butylphenyl)-2,3,4,5,6-pentadeuteriobenzene |
|---|---|
| PubChem CID | 140946173 |
| Molecular Formula | C16H18 |
| Molecular Weight | 215.35 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | 1-(2-tert-butylphenyl)-2,3,4,5,6-pentadeuteriobenzene |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccccc2C(C)(C)C)c([2H])c1[2H] |
| InChI | InChI=1S/C16H18/c1-16(2,3)15-12-8-7-11-14(15)13-9-5-4-6-10-13/h4-12H,1-3H3/i4D,5D,6D,9D,10D |
| InChIKey | IRUFLAAZAAOXHM-NPMXJOAUSA-N |
| XLogP | 4.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.35 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |