C32H32 — CID 166497085
2,3-ditert-butyltetraphenylene (PubChem CID 166497085) has the molecular formula C32H32 and a molecular weight of 416.61 g/mol. Its IUPAC name is 2,3-ditert-butyltetraphenylene.
| Compound Name | 2,3-ditert-butyltetraphenylene |
|---|---|
| PubChem CID | 166497085 |
| Molecular Formula | C32H32 |
| Molecular Weight | 416.61 g/mol |
| Exact Mass | 416.25 |
| IUPAC Name | 2,3-ditert-butyltetraphenylene |
| SMILES | CC(C)(C)c1cc2c(cc1C(C)(C)C)-c1ccccc1-c1ccccc1-c1ccccc1-2 |
| InChI | InChI=1S/C32H32/c1-31(2,3)29-19-27-25-17-11-9-15-23(25)21-13-7-8-14-22(21)24-16-10-12-18-26(24)28(27)20-30(29)32(4,5)6/h7-20H,1-6H3/b23-21-,24-22-,27-25-,28-26- |
| InChIKey | WELHPWHORUOEPD-QRONBFSESA-N |
| XLogP | 9.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.61 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |