C30H42O3 — CID 160602992
1,2-ditert-butylbenzene;5,6-ditert-butyl-2-benzofuran-1,3-dione (PubChem CID 160602992) has the molecular formula C30H42O3 and a molecular weight of 450.66 g/mol. Its IUPAC name is 1,2-ditert-butylbenzene;5,6-ditert-butyl-2-benzofuran-1,3-dione.
| Compound Name | 1,2-ditert-butylbenzene;5,6-ditert-butyl-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 160602992 |
| Molecular Formula | C30H42O3 |
| Molecular Weight | 450.66 g/mol |
| Exact Mass | 450.31 |
| IUPAC Name | 1,2-ditert-butylbenzene;5,6-ditert-butyl-2-benzofuran-1,3-dione |
| SMILES | CC(C)(C)c1cc2c(cc1C(C)(C)C)C(=O)OC2=O.CC(C)(C)c1ccccc1C(C)(C)C |
| InChI | InChI=1S/C16H20O3.C14H22/c1-15(2,3)11-7-9-10(14(18)19-13(9)17)8-12(11)16(4,5)6;1-13(2,3)11-9-7-8-10-12(11)14(4,5)6/h7-8H,1-6H3;7-10H,1-6H3 |
| InChIKey | RENGAONYZAIFHT-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.66 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|