C22H26O — CID 58769690
2,3-ditert-butyl-10H-anthracen-9-one (PubChem CID 58769690) has the molecular formula C22H26O and a molecular weight of 306.45 g/mol. Its IUPAC name is 2,3-ditert-butyl-10H-anthracen-9-one.
| Compound Name | 2,3-ditert-butyl-10H-anthracen-9-one |
|---|---|
| PubChem CID | 58769690 |
| Molecular Formula | C22H26O |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.20 |
| IUPAC Name | 2,3-ditert-butyl-10H-anthracen-9-one |
| SMILES | CC(C)(C)c1cc2c(cc1C(C)(C)C)C(=O)c1ccccc1C2 |
| InChI | InChI=1S/C22H26O/c1-21(2,3)18-12-15-11-14-9-7-8-10-16(14)20(23)17(15)13-19(18)22(4,5)6/h7-10,12-13H,11H2,1-6H3 |
| InChIKey | DMXZYVSYGPIQRI-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |