C21H26 — CID 175163483
1,3-ditert-butyl-9H-fluorene (PubChem CID 175163483) has the molecular formula C21H26 and a molecular weight of 278.44 g/mol. Its IUPAC name is 1,3-ditert-butyl-9H-fluorene.
| Compound Name | 1,3-ditert-butyl-9H-fluorene |
|---|---|
| PubChem CID | 175163483 |
| Molecular Formula | C21H26 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | 1,3-ditert-butyl-9H-fluorene |
| SMILES | CC(C)(C)c1cc2c(c(C(C)(C)C)c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C21H26/c1-20(2,3)15-12-17-16-10-8-7-9-14(16)11-18(17)19(13-15)21(4,5)6/h7-10,12-13H,11H2,1-6H3 |
| InChIKey | FOEMHXTYTVONIP-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |