C19H21Cl2N — CID 87185294
N-[1,2-dichloro-1-(9H-fluoren-1-yl)ethyl]-2-methylpropan-2-amine (PubChem CID 87185294) has the molecular formula C19H21Cl2N and a molecular weight of 334.29 g/mol. Its IUPAC name is N-[1,2-dichloro-1-(9H-fluoren-1-yl)ethyl]-2-methylpropan-2-amine.
| Compound Name | N-[1,2-dichloro-1-(9H-fluoren-1-yl)ethyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 87185294 |
| Molecular Formula | C19H21Cl2N |
| Molecular Weight | 334.29 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | N-[1,2-dichloro-1-(9H-fluoren-1-yl)ethyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(C)NC(Cl)(CCl)c1cccc2c1Cc1ccccc1-2 |
| InChI | InChI=1S/C19H21Cl2N/c1-18(2,3)22-19(21,12-20)17-10-6-9-15-14-8-5-4-7-13(14)11-16(15)17/h4-10,22H,11-12H2,1-3H3 |
| InChIKey | FHGRVVATQVQMAD-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.29 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|