C21H28N2 — CID 151812419
1-N,2-N-ditert-butyl-9H-fluorene-1,2-diamine (PubChem CID 151812419) has the molecular formula C21H28N2 and a molecular weight of 308.47 g/mol. Its IUPAC name is 1-N,2-N-ditert-butyl-9H-fluorene-1,2-diamine.
| Compound Name | 1-N,2-N-ditert-butyl-9H-fluorene-1,2-diamine |
|---|---|
| PubChem CID | 151812419 |
| Molecular Formula | C21H28N2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.23 |
| IUPAC Name | 1-N,2-N-ditert-butyl-9H-fluorene-1,2-diamine |
| SMILES | CC(C)(C)Nc1ccc2c(c1NC(C)(C)C)Cc1ccccc1-2 |
| InChI | InChI=1S/C21H28N2/c1-20(2,3)22-18-12-11-16-15-10-8-7-9-14(15)13-17(16)19(18)23-21(4,5)6/h7-12,22-23H,13H2,1-6H3 |
| InChIKey | SAWXIYUSHFUCNS-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |