C15H14O — CID 162039436
1,2-dimethyl-9H-fluoren-3-ol (PubChem CID 162039436) has the molecular formula C15H14O and a molecular weight of 210.28 g/mol. Its IUPAC name is 1,2-dimethyl-9H-fluoren-3-ol.
| Compound Name | 1,2-dimethyl-9H-fluoren-3-ol |
|---|---|
| PubChem CID | 162039436 |
| Molecular Formula | C15H14O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 1,2-dimethyl-9H-fluoren-3-ol |
| SMILES | Cc1c(O)cc2c(c1C)Cc1ccccc1-2 |
| InChI | InChI=1S/C15H14O/c1-9-10(2)15(16)8-14-12-6-4-3-5-11(12)7-13(9)14/h3-6,8,16H,7H2,1-2H3 |
| InChIKey | XKBWPOASXVUVAZ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |