C15H15BO2 — CID 142743472
(1,2-dimethyl-9H-fluoren-4-yl)boronic acid (PubChem CID 142743472) has the molecular formula C15H15BO2 and a molecular weight of 238.10 g/mol. Its IUPAC name is (1,2-dimethyl-9H-fluoren-4-yl)boronic acid.
| Compound Name | (1,2-dimethyl-9H-fluoren-4-yl)boronic acid |
|---|---|
| PubChem CID | 142743472 |
| Molecular Formula | C15H15BO2 |
| Molecular Weight | 238.10 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | (1,2-dimethyl-9H-fluoren-4-yl)boronic acid |
| SMILES | Cc1cc(B(O)O)c2c(c1C)Cc1ccccc1-2 |
| InChI | InChI=1S/C15H15BO2/c1-9-7-14(16(17)18)15-12-6-4-3-5-11(12)8-13(15)10(9)2/h3-7,17-18H,8H2,1-2H3 |
| InChIKey | WUBMRHXOPYYDCE-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.10 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|