C27H20 — CID 173160450
9H-fluorene;9-methyltetracyclo[6.5.0.04,12.05,10]trideca-1(13),2,4(12),5(10),6,8-hexaene (PubChem CID 173160450) has the molecular formula C27H20 and a molecular weight of 344.46 g/mol. Its IUPAC name is 9H-fluorene;9-methyltetracyclo[6.5.0.04,12.05,10]trideca-1(13),2,4(12),5(10),6,8-hexaene.
| Compound Name | 9H-fluorene;9-methyltetracyclo[6.5.0.04,12.05,10]trideca-1(13),2,4(12),5(10),6,8-hexaene |
|---|---|
| PubChem CID | 173160450 |
| Molecular Formula | C27H20 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 9H-fluorene;9-methyltetracyclo[6.5.0.04,12.05,10]trideca-1(13),2,4(12),5(10),6,8-hexaene |
| SMILES | Cc1c2ccc3c1Cc1cc-2ccc1-3.c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C14H10.C13H10/c1-8-11-4-5-13-12-3-2-9(11)6-10(12)7-14(8)13;1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12/h2-6H,7H2,1H3;1-8H,9H2 |
| InChIKey | OXMZYQKCKITZII-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |