C45H42 — CID 159443497
1,2-dimethyl-9H-fluorene;2,3-dimethyl-9H-fluorene;3,4-dimethyl-9H-fluorene (PubChem CID 159443497) has the molecular formula C45H42 and a molecular weight of 582.83 g/mol. Its IUPAC name is 1,2-dimethyl-9H-fluorene;2,3-dimethyl-9H-fluorene;3,4-dimethyl-9H-fluorene.
| Compound Name | 1,2-dimethyl-9H-fluorene;2,3-dimethyl-9H-fluorene;3,4-dimethyl-9H-fluorene |
|---|---|
| PubChem CID | 159443497 |
| Molecular Formula | C45H42 |
| Molecular Weight | 582.83 g/mol |
| Exact Mass | 582.33 |
| IUPAC Name | 1,2-dimethyl-9H-fluorene;2,3-dimethyl-9H-fluorene;3,4-dimethyl-9H-fluorene |
| SMILES | Cc1cc2c(cc1C)-c1ccccc1C2.Cc1ccc2c(c1C)-c1ccccc1C2.Cc1ccc2c(c1C)Cc1ccccc1-2 |
| InChI | InChI=1S/3C15H14/c1-10-7-13-9-12-5-3-4-6-14(12)15(13)8-11(10)2;1-10-7-8-13-9-12-5-3-4-6-14(12)15(13)11(10)2;1-10-7-8-14-13-6-4-3-5-12(13)9-15(14)11(10)2/h3*3-8H,9H2,1-2H3 |
| InChIKey | LSLSEWXJTXRJLH-UHFFFAOYSA-N |
| XLogP | 11.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.83 |
| LogP ≤ 5 | 11.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |