C17H18 — CID 158222365
1,3,4,5-tetramethyl-9H-fluorene (PubChem CID 158222365) has the molecular formula C17H18 and a molecular weight of 222.33 g/mol. Its IUPAC name is 1,3,4,5-tetramethyl-9H-fluorene.
| Compound Name | 1,3,4,5-tetramethyl-9H-fluorene |
|---|---|
| PubChem CID | 158222365 |
| Molecular Formula | C17H18 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 1,3,4,5-tetramethyl-9H-fluorene |
| SMILES | Cc1cc(C)c2c(c1C)-c1c(C)cccc1C2 |
| InChI | InChI=1S/C17H18/c1-10-6-5-7-14-9-15-12(3)8-11(2)13(4)17(15)16(10)14/h5-8H,9H2,1-4H3 |
| InChIKey | PUYWNMVRTQDSMH-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |