C21H20O2 — CID 162146644
2,6-dimethylbenzene-1,4-diol;9H-fluorene (PubChem CID 162146644) has the molecular formula C21H20O2 and a molecular weight of 304.39 g/mol. Its IUPAC name is 2,6-dimethylbenzene-1,4-diol;9H-fluorene.
| Compound Name | 2,6-dimethylbenzene-1,4-diol;9H-fluorene |
|---|---|
| PubChem CID | 162146644 |
| Molecular Formula | C21H20O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 2,6-dimethylbenzene-1,4-diol;9H-fluorene |
| SMILES | Cc1cc(O)cc(C)c1O.c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C13H10.C8H10O2/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;1-5-3-7(9)4-6(2)8(5)10/h1-8H,9H2;3-4,9-10H,1-2H3 |
| InChIKey | ZKQKIONCMGEAKS-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|