About ethane;9H-fluoren-2-ol
ethane;9H-fluoren-2-ol (PubChem CID 91146688) has the molecular formula C15H16O
and a molecular weight of 212.29 g/mol. Its IUPAC name is ethane;9H-fluoren-2-ol.
Molecular Properties
| Compound Name | ethane;9H-fluoren-2-ol |
| PubChem CID | 91146688 |
| Molecular Formula | C15H16O |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | ethane;9H-fluoren-2-ol |
| SMILES | CC.Oc1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C13H10O.C2H6/c14-11-5-6-13-10(8-11)7-9-3-1-2-4-12(9)13;1-2/h1-6,8,14H,7H2;1-2H3 |
| InChIKey | YMOKBWWNOMXWBY-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;9H-fluoren-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;9H-fluoren-2-ol?
The IUPAC name of ethane;9H-fluoren-2-ol (CID 91146688) is ethane;9H-fluoren-2-ol.
What is the SMILES notation for ethane;9H-fluoren-2-ol?
The canonical SMILES for ethane;9H-fluoren-2-ol is CC.Oc1ccc2c(c1)Cc1ccccc1-2.
What is the InChIKey of ethane;9H-fluoren-2-ol?
The InChIKey is YMOKBWWNOMXWBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O.C2H6/c14-11-5-6-13-10(8-11)7-9-3-1-2-4-12(9)13;1-2/h1-6,8,14H,7H2;1-2H3.
What are the key properties of ethane;9H-fluoren-2-ol?
ethane;9H-fluoren-2-ol has a molecular weight of 212.29 g/mol, XLogP of 3.99, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;9H-fluoren-2-ol is sourced from PubChem (CID 91146688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).