About 11H-benzo[b]fluoren-7-ol
11H-benzo[b]fluoren-7-ol (PubChem CID 123521714) has the molecular formula C17H12O
and a molecular weight of 232.28 g/mol. Its IUPAC name is 11H-benzo[b]fluoren-7-ol.
Molecular Properties
| Compound Name | 11H-benzo[b]fluoren-7-ol |
| PubChem CID | 123521714 |
| Molecular Formula | C17H12O |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | 11H-benzo[b]fluoren-7-ol |
| SMILES | Oc1ccc2cc3c(cc2c1)-c1ccccc1C3 |
| InChI | InChI=1S/C17H12O/c18-15-6-5-11-7-14-8-12-3-1-2-4-16(12)17(14)10-13(11)9-15/h1-7,9-10,18H,8H2 |
| InChIKey | ABTSKZOBMISJIF-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 11H-benzo[b]fluoren-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11H-benzo[b]fluoren-7-ol?
The IUPAC name of 11H-benzo[b]fluoren-7-ol (CID 123521714) is 11H-benzo[b]fluoren-7-ol.
What is the SMILES notation for 11H-benzo[b]fluoren-7-ol?
The canonical SMILES for 11H-benzo[b]fluoren-7-ol is Oc1ccc2cc3c(cc2c1)-c1ccccc1C3.
What is the InChIKey of 11H-benzo[b]fluoren-7-ol?
The InChIKey is ABTSKZOBMISJIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12O/c18-15-6-5-11-7-14-8-12-3-1-2-4-16(12)17(14)10-13(11)9-15/h1-7,9-10,18H,8H2.
What are the key properties of 11H-benzo[b]fluoren-7-ol?
11H-benzo[b]fluoren-7-ol has a molecular weight of 232.28 g/mol, XLogP of 4.12, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 11H-benzo[b]fluoren-7-ol is sourced from PubChem (CID 123521714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).