C16H18O — CID 91093084
9,10-dihydrophenanthren-2-ol;ethane (PubChem CID 91093084) has the molecular formula C16H18O and a molecular weight of 226.32 g/mol. Its IUPAC name is 9,10-dihydrophenanthren-2-ol;ethane.
| Compound Name | 9,10-dihydrophenanthren-2-ol;ethane |
|---|---|
| PubChem CID | 91093084 |
| Molecular Formula | C16H18O |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | 9,10-dihydrophenanthren-2-ol;ethane |
| SMILES | CC.Oc1ccc2c(c1)CCc1ccccc1-2 |
| InChI | InChI=1S/C14H12O.C2H6/c15-12-7-8-14-11(9-12)6-5-10-3-1-2-4-13(10)14;1-2/h1-4,7-9,15H,5-6H2;1-2H3 |
| InChIKey | QCBOTVCPGFVZCL-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |