C16H16 — CID 90783732
5-methyltricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaene (PubChem CID 90783732) has the molecular formula C16H16 and a molecular weight of 208.30 g/mol. Its IUPAC name is 5-methyltricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaene.
| Compound Name | 5-methyltricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaene |
|---|---|
| PubChem CID | 90783732 |
| Molecular Formula | C16H16 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 5-methyltricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaene |
| SMILES | Cc1ccc2c(c1)CCCc1ccccc1-2 |
| InChI | InChI=1S/C16H16/c1-12-9-10-16-14(11-12)7-4-6-13-5-2-3-8-15(13)16/h2-3,5,8-11H,4,6-7H2,1H3 |
| InChIKey | KEWKWMSOBQNUEA-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |