C20H30 — CID 143759681
9,10-dihydrophenanthrene;ethane (PubChem CID 143759681) has the molecular formula C20H30 and a molecular weight of 270.46 g/mol. Its IUPAC name is 9,10-dihydrophenanthrene;ethane.
| Compound Name | 9,10-dihydrophenanthrene;ethane |
|---|---|
| PubChem CID | 143759681 |
| Molecular Formula | C20H30 |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.23 |
| IUPAC Name | 9,10-dihydrophenanthrene;ethane |
| SMILES | CC.CC.CC.c1ccc2c(c1)CCc1ccccc1-2 |
| InChI | InChI=1S/C14H12.3C2H6/c1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)13;3*1-2/h1-8H,9-10H2;3*1-2H3 |
| InChIKey | SOUOYNSYQSQNDD-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |