C18H18 — CID 59340364
2-propan-2-ylidenetricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene (PubChem CID 59340364) has the molecular formula C18H18 and a molecular weight of 234.34 g/mol. Its IUPAC name is 2-propan-2-ylidenetricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene.
| Compound Name | 2-propan-2-ylidenetricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene |
|---|---|
| PubChem CID | 59340364 |
| Molecular Formula | C18H18 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 2-propan-2-ylidenetricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene |
| SMILES | CC(C)=C1c2ccccc2CCc2ccccc21 |
| InChI | InChI=1S/C18H18/c1-13(2)18-16-9-5-3-7-14(16)11-12-15-8-4-6-10-17(15)18/h3-10H,11-12H2,1-2H3 |
| InChIKey | JICXQQZWHFIWMQ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'styrene_A(13)', 'substructure': 'N/A'} |
|---|