C12H11N — CID 54118833
(3Z)-3-(1-isocyanoethylidene)-1,2-dihydroindene (PubChem CID 54118833) has the molecular formula C12H11N and a molecular weight of 169.23 g/mol. Its IUPAC name is (3Z)-3-(1-isocyanoethylidene)-1,2-dihydroindene.
| Compound Name | (3Z)-3-(1-isocyanoethylidene)-1,2-dihydroindene |
|---|---|
| PubChem CID | 54118833 |
| Molecular Formula | C12H11N |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | (3Z)-3-(1-isocyanoethylidene)-1,2-dihydroindene |
| SMILES | [C-]#[N+]/C(C)=C1/CCc2ccccc21 |
| InChI | InChI=1S/C12H11N/c1-9(13-2)11-8-7-10-5-3-4-6-12(10)11/h3-6H,7-8H2,1H3/b11-9- |
| InChIKey | LPEWPJCDQLPWSV-LUAWRHEFSA-N |
| XLogP | 3.28 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|