C16H24O2Si — CID 102398395
[(Z)-2,3-dihydroinden-1-ylidene(propan-2-yloxy)methoxy]-trimethylsilane (PubChem CID 102398395) has the molecular formula C16H24O2Si and a molecular weight of 276.45 g/mol. Its IUPAC name is [(Z)-2,3-dihydroinden-1-ylidene(propan-2-yloxy)methoxy]-trimethylsilane.
| Compound Name | [(Z)-2,3-dihydroinden-1-ylidene(propan-2-yloxy)methoxy]-trimethylsilane |
|---|---|
| PubChem CID | 102398395 |
| Molecular Formula | C16H24O2Si |
| Molecular Weight | 276.45 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | [(Z)-2,3-dihydroinden-1-ylidene(propan-2-yloxy)methoxy]-trimethylsilane |
| SMILES | CC(C)O/C(O[Si](C)(C)C)=C1\CCc2ccccc21 |
| InChI | InChI=1S/C16H24O2Si/c1-12(2)17-16(18-19(3,4)5)15-11-10-13-8-6-7-9-14(13)15/h6-9,12H,10-11H2,1-5H3/b16-15- |
| InChIKey | JZNIQKZCHXDWMS-NXVVXOECSA-N |
| XLogP | 4.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.45 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|