C15H20O2Si — CID 86033686
1-(1-trimethylsilyloxy-3,4-dihydronaphthalen-2-yl)ethanone (PubChem CID 86033686) has the molecular formula C15H20O2Si and a molecular weight of 260.41 g/mol. Its IUPAC name is 1-(1-trimethylsilyloxy-3,4-dihydronaphthalen-2-yl)ethanone.
| Compound Name | 1-(1-trimethylsilyloxy-3,4-dihydronaphthalen-2-yl)ethanone |
|---|---|
| PubChem CID | 86033686 |
| Molecular Formula | C15H20O2Si |
| Molecular Weight | 260.41 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 1-(1-trimethylsilyloxy-3,4-dihydronaphthalen-2-yl)ethanone |
| SMILES | CC(=O)C1=C(O[Si](C)(C)C)c2ccccc2CC1 |
| InChI | InChI=1S/C15H20O2Si/c1-11(16)13-10-9-12-7-5-6-8-14(12)15(13)17-18(2,3)4/h5-8H,9-10H2,1-4H3 |
| InChIKey | RRHLAKRPGMMRGI-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.41 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|