C15H18O2 — CID 115057843
1-tert-butyl-3,4-dihydronaphthalene-2-carboxylic acid (PubChem CID 115057843) has the molecular formula C15H18O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is 1-tert-butyl-3,4-dihydronaphthalene-2-carboxylic acid.
| Compound Name | 1-tert-butyl-3,4-dihydronaphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 115057843 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 1-tert-butyl-3,4-dihydronaphthalene-2-carboxylic acid |
| SMILES | CC(C)(C)C1=C(C(=O)O)CCc2ccccc21 |
| InChI | InChI=1S/C15H18O2/c1-15(2,3)13-11-7-5-4-6-10(11)8-9-12(13)14(16)17/h4-7H,8-9H2,1-3H3,(H,16,17) |
| InChIKey | VPCFYKPXEDEXMK-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |