C20H32O2Si2 — CID 57374260
(6,9-dimethyl-5-trimethylsilyloxy-7,8-dihydrobenzo[8]annulen-10-yl)oxy-trimethylsilane (PubChem CID 57374260) has the molecular formula C20H32O2Si2 and a molecular weight of 360.65 g/mol. Its IUPAC name is (6,9-dimethyl-5-trimethylsilyloxy-7,8-dihydrobenzo[8]annulen-10-yl)oxy-trimethylsilane.
| Compound Name | (6,9-dimethyl-5-trimethylsilyloxy-7,8-dihydrobenzo[8]annulen-10-yl)oxy-trimethylsilane |
|---|---|
| PubChem CID | 57374260 |
| Molecular Formula | C20H32O2Si2 |
| Molecular Weight | 360.65 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | (6,9-dimethyl-5-trimethylsilyloxy-7,8-dihydrobenzo[8]annulen-10-yl)oxy-trimethylsilane |
| SMILES | CC1=C(O[Si](C)(C)C)c2ccccc2C(O[Si](C)(C)C)=C(C)CC1 |
| InChI | InChI=1S/C20H32O2Si2/c1-15-13-14-16(2)20(22-24(6,7)8)18-12-10-9-11-17(18)19(15)21-23(3,4)5/h9-12H,13-14H2,1-8H3 |
| InChIKey | GTIDMDLXHUABGP-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.65 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|