C14H26O2Si2 — CID 153432726
(3,6-dimethyl-2-trimethylsilyloxyphenoxy)-trimethylsilane (PubChem CID 153432726) has the molecular formula C14H26O2Si2 and a molecular weight of 282.53 g/mol. Its IUPAC name is (3,6-dimethyl-2-trimethylsilyloxyphenoxy)-trimethylsilane.
| Compound Name | (3,6-dimethyl-2-trimethylsilyloxyphenoxy)-trimethylsilane |
|---|---|
| PubChem CID | 153432726 |
| Molecular Formula | C14H26O2Si2 |
| Molecular Weight | 282.53 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | (3,6-dimethyl-2-trimethylsilyloxyphenoxy)-trimethylsilane |
| SMILES | Cc1ccc(C)c(O[Si](C)(C)C)c1O[Si](C)(C)C |
| InChI | InChI=1S/C14H26O2Si2/c1-11-9-10-12(2)14(16-18(6,7)8)13(11)15-17(3,4)5/h9-10H,1-8H3 |
| InChIKey | FYMPIUOKKZQRHT-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.53 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|