C14H20OSi — CID 102338034
(4,7-dimethyl-3H-inden-1-yl)oxy-trimethylsilane (PubChem CID 102338034) has the molecular formula C14H20OSi and a molecular weight of 232.40 g/mol. Its IUPAC name is (4,7-dimethyl-3H-inden-1-yl)oxy-trimethylsilane.
| Compound Name | (4,7-dimethyl-3H-inden-1-yl)oxy-trimethylsilane |
|---|---|
| PubChem CID | 102338034 |
| Molecular Formula | C14H20OSi |
| Molecular Weight | 232.40 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | (4,7-dimethyl-3H-inden-1-yl)oxy-trimethylsilane |
| SMILES | Cc1ccc(C)c2c1CC=C2O[Si](C)(C)C |
| InChI | InChI=1S/C14H20OSi/c1-10-6-7-11(2)14-12(10)8-9-13(14)15-16(3,4)5/h6-7,9H,8H2,1-5H3 |
| InChIKey | PZQOOAZKMUKTQR-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.40 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|