C13H16 — CID 10942918
2,3,4,7-tetramethyl-1H-indene (PubChem CID 10942918) has the molecular formula C13H16 and a molecular weight of 172.27 g/mol. Its IUPAC name is 2,3,4,7-tetramethyl-1H-indene.
| Compound Name | 2,3,4,7-tetramethyl-1H-indene |
|---|---|
| PubChem CID | 10942918 |
| Molecular Formula | C13H16 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.13 |
| IUPAC Name | 2,3,4,7-tetramethyl-1H-indene |
| SMILES | CC1=C(C)c2c(C)ccc(C)c2C1 |
| InChI | InChI=1S/C13H16/c1-8-5-6-9(2)13-11(4)10(3)7-12(8)13/h5-6H,7H2,1-4H3 |
| InChIKey | SPJFFPGMVIHWLQ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |