C14H16U — CID 58001395
2-ethyl-3-methanidyl-4,7-dimethyl-1H-indene;uranium(2+) (PubChem CID 58001395) has the molecular formula C14H16U and a molecular weight of 422.31 g/mol. Its IUPAC name is 2-ethyl-3-methanidyl-4,7-dimethyl-1H-indene;uranium(2+).
| Compound Name | 2-ethyl-3-methanidyl-4,7-dimethyl-1H-indene;uranium(2+) |
|---|---|
| PubChem CID | 58001395 |
| Molecular Formula | C14H16U |
| Molecular Weight | 422.31 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 2-ethyl-3-methanidyl-4,7-dimethyl-1H-indene;uranium(2+) |
| SMILES | [CH2-]CC1=C([CH2-])c2c(C)ccc(C)c2C1.[U+2] |
| InChI | InChI=1S/C14H16.U/c1-5-12-8-13-9(2)6-7-10(3)14(13)11(12)4;/h6-7H,1,4-5,8H2,2-3H3;/q-2;+2 |
| InChIKey | KXLAFQGMVNYMDR-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.31 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|