C12H14O — CID 23625905
3-methoxy-2,7-dimethyl-1H-indene (PubChem CID 23625905) has the molecular formula C12H14O and a molecular weight of 174.24 g/mol. Its IUPAC name is 3-methoxy-2,7-dimethyl-1H-indene.
| Compound Name | 3-methoxy-2,7-dimethyl-1H-indene |
|---|---|
| PubChem CID | 23625905 |
| Molecular Formula | C12H14O |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | 3-methoxy-2,7-dimethyl-1H-indene |
| SMILES | COC1=C(C)Cc2c(C)cccc21 |
| InChI | InChI=1S/C12H14O/c1-8-5-4-6-10-11(8)7-9(2)12(10)13-3/h4-6H,7H2,1-3H3 |
| InChIKey | IFCJKTJVGSRXHF-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |