C12H12O — CID 158508718
4,8-dimethyl-1H-naphthalen-2-one (PubChem CID 158508718) has the molecular formula C12H12O and a molecular weight of 172.23 g/mol. Its IUPAC name is 4,8-dimethyl-1H-naphthalen-2-one.
| Compound Name | 4,8-dimethyl-1H-naphthalen-2-one |
|---|---|
| PubChem CID | 158508718 |
| Molecular Formula | C12H12O |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.09 |
| IUPAC Name | 4,8-dimethyl-1H-naphthalen-2-one |
| SMILES | CC1=CC(=O)Cc2c(C)cccc21 |
| InChI | InChI=1S/C12H12O/c1-8-4-3-5-11-9(2)6-10(13)7-12(8)11/h3-6H,7H2,1-2H3 |
| InChIKey | QDGWOBLMFSEZCJ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |