C18H18 — CID 22259782
4-(2,3-dimethylphenyl)-2-methyl-1H-indene (PubChem CID 22259782) has the molecular formula C18H18 and a molecular weight of 234.34 g/mol. Its IUPAC name is 4-(2,3-dimethylphenyl)-2-methyl-1H-indene.
| Compound Name | 4-(2,3-dimethylphenyl)-2-methyl-1H-indene |
|---|---|
| PubChem CID | 22259782 |
| Molecular Formula | C18H18 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 4-(2,3-dimethylphenyl)-2-methyl-1H-indene |
| SMILES | CC1=Cc2c(cccc2-c2cccc(C)c2C)C1 |
| InChI | InChI=1S/C18H18/c1-12-10-15-7-5-9-17(18(15)11-12)16-8-4-6-13(2)14(16)3/h4-9,11H,10H2,1-3H3 |
| InChIKey | FAWUXOBXEWISFX-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |