C18H12F6 — CID 141003705
4-[2,6-bis(trifluoromethyl)phenyl]-2-methyl-1H-indene (PubChem CID 141003705) has the molecular formula C18H12F6 and a molecular weight of 342.28 g/mol. Its IUPAC name is 4-[2,6-bis(trifluoromethyl)phenyl]-2-methyl-1H-indene.
| Compound Name | 4-[2,6-bis(trifluoromethyl)phenyl]-2-methyl-1H-indene |
|---|---|
| PubChem CID | 141003705 |
| Molecular Formula | C18H12F6 |
| Molecular Weight | 342.28 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 4-[2,6-bis(trifluoromethyl)phenyl]-2-methyl-1H-indene |
| SMILES | CC1=Cc2c(cccc2-c2c(C(F)(F)F)cccc2C(F)(F)F)C1 |
| InChI | InChI=1S/C18H12F6/c1-10-8-11-4-2-5-12(13(11)9-10)16-14(17(19,20)21)6-3-7-15(16)18(22,23)24/h2-7,9H,8H2,1H3 |
| InChIKey | ZBONYSGPEBEOHQ-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.28 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |