C16H12Cl2F2Zr — CID 175439244
dichlorozirconium;4-(3,5-difluorophenyl)-2-methyl-1H-indene (PubChem CID 175439244) has the molecular formula C16H12Cl2F2Zr and a molecular weight of 404.40 g/mol. Its IUPAC name is dichlorozirconium;4-(3,5-difluorophenyl)-2-methyl-1H-indene.
| Compound Name | dichlorozirconium;4-(3,5-difluorophenyl)-2-methyl-1H-indene |
|---|---|
| PubChem CID | 175439244 |
| Molecular Formula | C16H12Cl2F2Zr |
| Molecular Weight | 404.40 g/mol |
| Exact Mass | 401.93 |
| IUPAC Name | dichlorozirconium;4-(3,5-difluorophenyl)-2-methyl-1H-indene |
| SMILES | CC1=Cc2c(cccc2-c2cc(F)cc(F)c2)C1.Cl[Zr]Cl |
| InChI | InChI=1S/C16H12F2.2ClH.Zr/c1-10-5-11-3-2-4-15(16(11)6-10)12-7-13(17)9-14(18)8-12;;;/h2-4,6-9H,5H2,1H3;2*1H;/q;;;+2/p-2 |
| InChIKey | ITEZJBJLBRLDQJ-UHFFFAOYSA-L |
| XLogP | 5.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.40 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |