About dichlorozirconium;2-propan-2-yl-4-[4-(trifluoromethyl)phenyl]-1H-indene
dichlorozirconium;2-propan-2-yl-4-[4-(trifluoromethyl)phenyl]-1H-indene (PubChem CID 174516204) has the molecular formula C19H17Cl2F3Zr
and a molecular weight of 464.47 g/mol. Its IUPAC name is dichlorozirconium;2-propan-2-yl-4-[4-(trifluoromethyl)phenyl]-1H-indene.
Molecular Properties
| Compound Name | dichlorozirconium;2-propan-2-yl-4-[4-(trifluoromethyl)phenyl]-1H-indene |
| PubChem CID | 174516204 |
| Molecular Formula | C19H17Cl2F3Zr |
| Molecular Weight | 464.47 g/mol |
| Exact Mass | 461.97 |
| IUPAC Name | dichlorozirconium;2-propan-2-yl-4-[4-(trifluoromethyl)phenyl]-1H-indene |
| SMILES | CC(C)C1=Cc2c(cccc2-c2ccc(C(F)(F)F)cc2)C1.Cl[Zr]Cl |
| InChI | InChI=1S/C19H17F3.2ClH.Zr/c1-12(2)15-10-14-4-3-5-17(18(14)11-15)13-6-8-16(9-7-13)19(20,21)22;;;/h3-9,11-12H,10H2,1-2H3;2*1H;/q;;;+2/p-2 |
| InChIKey | NNQLVCZFUCZRQX-UHFFFAOYSA-L |
| XLogP | 7.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 464.47 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze dichlorozirconium;2-propan-2-yl-4-[4-(trifluoromethyl)phenyl]-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlorozirconium;2-propan-2-yl-4-[4-(trifluoromethyl)phenyl]-1H-indene?
The IUPAC name of dichlorozirconium;2-propan-2-yl-4-[4-(trifluoromethyl)phenyl]-1H-indene (CID 174516204) is dichlorozirconium;2-propan-2-yl-4-[4-(trifluoromethyl)phenyl]-1H-indene.
What is the SMILES notation for dichlorozirconium;2-propan-2-yl-4-[4-(trifluoromethyl)phenyl]-1H-indene?
The canonical SMILES for dichlorozirconium;2-propan-2-yl-4-[4-(trifluoromethyl)phenyl]-1H-indene is CC(C)C1=Cc2c(cccc2-c2ccc(C(F)(F)F)cc2)C1.Cl[Zr]Cl.
What is the InChIKey of dichlorozirconium;2-propan-2-yl-4-[4-(trifluoromethyl)phenyl]-1H-indene?
The InChIKey is NNQLVCZFUCZRQX-UHFFFAOYSA-L. The full InChI is InChI=1S/C19H17F3.2ClH.Zr/c1-12(2)15-10-14-4-3-5-17(18(14)11-15)13-6-8-16(9-7-13)19(20,21)22;;;/h3-9,11-12H,10H2,1-2H3;2*1H;/q;;;+2/p-2.
What are the key properties of dichlorozirconium;2-propan-2-yl-4-[4-(trifluoromethyl)phenyl]-1H-indene?
dichlorozirconium;2-propan-2-yl-4-[4-(trifluoromethyl)phenyl]-1H-indene has a molecular weight of 464.47 g/mol, XLogP of 7.34, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichlorozirconium;2-propan-2-yl-4-[4-(trifluoromethyl)phenyl]-1H-indene is sourced from PubChem (CID 174516204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).