About 4-[3,5-bis(trifluoromethyl)phenyl]-2-(trifluoromethyl)-1H-indene
4-[3,5-bis(trifluoromethyl)phenyl]-2-(trifluoromethyl)-1H-indene (PubChem CID 173192696) has the molecular formula C18H9F9
and a molecular weight of 396.25 g/mol. Its IUPAC name is 4-[3,5-bis(trifluoromethyl)phenyl]-2-(trifluoromethyl)-1H-indene.
Molecular Properties
| Compound Name | 4-[3,5-bis(trifluoromethyl)phenyl]-2-(trifluoromethyl)-1H-indene |
| PubChem CID | 173192696 |
| Molecular Formula | C18H9F9 |
| Molecular Weight | 396.25 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | 4-[3,5-bis(trifluoromethyl)phenyl]-2-(trifluoromethyl)-1H-indene |
| SMILES | FC(F)(F)C1=Cc2c(cccc2-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C18H9F9/c19-16(20,21)11-5-10(6-12(7-11)17(22,23)24)14-3-1-2-9-4-13(8-15(9)14)18(25,26)27/h1-3,5-8H,4H2 |
| InChIKey | NJZTTZDPRWJJKA-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.25 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 4-[3,5-bis(trifluoromethyl)phenyl]-2-(trifluoromethyl)-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3,5-bis(trifluoromethyl)phenyl]-2-(trifluoromethyl)-1H-indene?
The IUPAC name of 4-[3,5-bis(trifluoromethyl)phenyl]-2-(trifluoromethyl)-1H-indene (CID 173192696) is 4-[3,5-bis(trifluoromethyl)phenyl]-2-(trifluoromethyl)-1H-indene.
What is the SMILES notation for 4-[3,5-bis(trifluoromethyl)phenyl]-2-(trifluoromethyl)-1H-indene?
The canonical SMILES for 4-[3,5-bis(trifluoromethyl)phenyl]-2-(trifluoromethyl)-1H-indene is FC(F)(F)C1=Cc2c(cccc2-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)C1.
What is the InChIKey of 4-[3,5-bis(trifluoromethyl)phenyl]-2-(trifluoromethyl)-1H-indene?
The InChIKey is NJZTTZDPRWJJKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H9F9/c19-16(20,21)11-5-10(6-12(7-11)17(22,23)24)14-3-1-2-9-4-13(8-15(9)14)18(25,26)27/h1-3,5-8H,4H2.
What are the key properties of 4-[3,5-bis(trifluoromethyl)phenyl]-2-(trifluoromethyl)-1H-indene?
4-[3,5-bis(trifluoromethyl)phenyl]-2-(trifluoromethyl)-1H-indene has a molecular weight of 396.25 g/mol, XLogP of 6.89, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3,5-bis(trifluoromethyl)phenyl]-2-(trifluoromethyl)-1H-indene is sourced from PubChem (CID 173192696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).