C21H18F6 — CID 141047271
4-[3,5-bis(trifluoromethyl)phenyl]-2-tert-butyl-1H-indene (PubChem CID 141047271) has the molecular formula C21H18F6 and a molecular weight of 384.36 g/mol. Its IUPAC name is 4-[3,5-bis(trifluoromethyl)phenyl]-2-tert-butyl-1H-indene.
| Compound Name | 4-[3,5-bis(trifluoromethyl)phenyl]-2-tert-butyl-1H-indene |
|---|---|
| PubChem CID | 141047271 |
| Molecular Formula | C21H18F6 |
| Molecular Weight | 384.36 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 4-[3,5-bis(trifluoromethyl)phenyl]-2-tert-butyl-1H-indene |
| SMILES | CC(C)(C)C1=Cc2c(cccc2-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C21H18F6/c1-19(2,3)14-7-12-5-4-6-17(18(12)11-14)13-8-15(20(22,23)24)10-16(9-13)21(25,26)27/h4-6,8-11H,7H2,1-3H3 |
| InChIKey | MGZATKKHPLVOSV-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.36 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |