C23H12F12 — CID 163637967
1,3-bis[3,5-bis(trifluoromethyl)phenyl]-2-methylbenzene (PubChem CID 163637967) has the molecular formula C23H12F12 and a molecular weight of 516.33 g/mol. Its IUPAC name is 1,3-bis[3,5-bis(trifluoromethyl)phenyl]-2-methylbenzene.
| Compound Name | 1,3-bis[3,5-bis(trifluoromethyl)phenyl]-2-methylbenzene |
|---|---|
| PubChem CID | 163637967 |
| Molecular Formula | C23H12F12 |
| Molecular Weight | 516.33 g/mol |
| Exact Mass | 516.07 |
| IUPAC Name | 1,3-bis[3,5-bis(trifluoromethyl)phenyl]-2-methylbenzene |
| SMILES | Cc1c(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cccc1-c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H12F12/c1-11-18(12-5-14(20(24,25)26)9-15(6-12)21(27,28)29)3-2-4-19(11)13-7-16(22(30,31)32)10-17(8-13)23(33,34)35/h2-10H,1H3 |
| InChIKey | IBVHUKWELKAPPY-UHFFFAOYSA-N |
| XLogP | 9.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.33 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |