C27H16F12NS+ — CID 90343080
3-[2,6-bis[3,5-bis(trifluoromethyl)phenyl]phenyl]-4,5-dimethyl-1,3-thiazol-3-ium (PubChem CID 90343080) has the molecular formula C27H16F12NS+ and a molecular weight of 614.48 g/mol. Its IUPAC name is 3-[2,6-bis[3,5-bis(trifluoromethyl)phenyl]phenyl]-4,5-dimethyl-1,3-thiazol-3-ium.
| Compound Name | 3-[2,6-bis[3,5-bis(trifluoromethyl)phenyl]phenyl]-4,5-dimethyl-1,3-thiazol-3-ium |
|---|---|
| PubChem CID | 90343080 |
| Molecular Formula | C27H16F12NS+ |
| Molecular Weight | 614.48 g/mol |
| Exact Mass | 614.08 |
| IUPAC Name | 3-[2,6-bis[3,5-bis(trifluoromethyl)phenyl]phenyl]-4,5-dimethyl-1,3-thiazol-3-ium |
| SMILES | Cc1sc[n+](-c2c(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)cccc2-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c1C |
| InChI | InChI=1S/C27H16F12NS/c1-13-14(2)41-12-40(13)23-21(15-6-17(24(28,29)30)10-18(7-15)25(31,32)33)4-3-5-22(23)16-8-19(26(34,35)36)11-20(9-16)27(37,38)39/h3-12H,1-2H3/q+1 |
| InChIKey | QKTDFDABUXLTOF-UHFFFAOYSA-N |
| XLogP | 10.05 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.48 |
| LogP ≤ 5 | 10.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|