C17H16Cl2Zr — CID 174528512
dichlorozirconium;2,6-dimethyl-4-phenyl-1H-indene (PubChem CID 174528512) has the molecular formula C17H16Cl2Zr and a molecular weight of 382.45 g/mol. Its IUPAC name is dichlorozirconium;2,6-dimethyl-4-phenyl-1H-indene.
| Compound Name | dichlorozirconium;2,6-dimethyl-4-phenyl-1H-indene |
|---|---|
| PubChem CID | 174528512 |
| Molecular Formula | C17H16Cl2Zr |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 379.97 |
| IUPAC Name | dichlorozirconium;2,6-dimethyl-4-phenyl-1H-indene |
| SMILES | CC1=Cc2c(cc(C)cc2-c2ccccc2)C1.Cl[Zr]Cl |
| InChI | InChI=1S/C17H16.2ClH.Zr/c1-12-8-15-9-13(2)11-17(15)16(10-12)14-6-4-3-5-7-14;;;/h3-8,10-11H,9H2,1-2H3;2*1H;/q;;;+2/p-2 |
| InChIKey | OGRXSRRCUYFOPT-UHFFFAOYSA-L |
| XLogP | 6.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |