C18H18O — CID 173192637
4-(4-methoxyphenyl)-2,6-dimethyl-1H-indene (PubChem CID 173192637) has the molecular formula C18H18O and a molecular weight of 250.34 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-2,6-dimethyl-1H-indene.
| Compound Name | 4-(4-methoxyphenyl)-2,6-dimethyl-1H-indene |
|---|---|
| PubChem CID | 173192637 |
| Molecular Formula | C18H18O |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 4-(4-methoxyphenyl)-2,6-dimethyl-1H-indene |
| SMILES | COc1ccc(-c2cc(C)cc3c2C=C(C)C3)cc1 |
| InChI | InChI=1S/C18H18O/c1-12-8-15-9-13(2)11-18(15)17(10-12)14-4-6-16(19-3)7-5-14/h4-8,10-11H,9H2,1-3H3 |
| InChIKey | QMHTYBQFBGVNDL-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |