C64H56N8O4 — CID 139190140
5,18-bis(4-methoxyphenyl)-7,16-dimethyl-3,10,13,20-tetrazapentacyclo[11.7.0.02,10.04,9.014,19]icosa-1(20),2,4,6,8,14,16,18-octaene (PubChem CID 139190140) has the molecular formula C64H56N8O4 and a molecular weight of 1001.20 g/mol. Its IUPAC name is 5,18-bis(4-methoxyphenyl)-7,16-dimethyl-3,10,13,20-tetrazapentacyclo[11.7.0.02,10.04,9.014,19]icosa-1(20),2,4,6,8,14,16,18-octaene.
| Compound Name | 5,18-bis(4-methoxyphenyl)-7,16-dimethyl-3,10,13,20-tetrazapentacyclo[11.7.0.02,10.04,9.014,19]icosa-1(20),2,4,6,8,14,16,18-octaene |
|---|---|
| PubChem CID | 139190140 |
| Molecular Formula | C64H56N8O4 |
| Molecular Weight | 1001.20 g/mol |
| Exact Mass | 1000.44 |
| IUPAC Name | 5,18-bis(4-methoxyphenyl)-7,16-dimethyl-3,10,13,20-tetrazapentacyclo[11.7.0.02,10.04,9.014,19]icosa-1(20),2,4,6,8,14,16,18-octaene |
| SMILES | COc1ccc(-c2cc(C)cc3c2nc2n3CCn3c-2nc2c(-c4ccc(OC)cc4)cc(C)cc23)cc1.COc1ccc(-c2cc(C)cc3c2nc2n3CCn3c-2nc2c(-c4ccc(OC)cc4)cc(C)cc23)cc1 |
| InChI | InChI=1S/2C32H28N4O2/c2*1-19-15-25(21-5-9-23(37-3)10-6-21)29-27(17-19)35-13-14-36-28-18-20(2)16-26(22-7-11-24(38-4)12-8-22)30(28)34-32(36)31(35)33-29/h2*5-12,15-18H,13-14H2,1-4H3 |
| InChIKey | YMXWYFWLQISOAT-UHFFFAOYSA-N |
| XLogP | 14.07 |
| TPSA | 108.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 76 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1001.20 |
| LogP ≤ 5 | 14.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |